C14H20FNO5 — CID 71770447
(2S,3R,4R,5S,6R)-2-[[(4-fluorophenyl)methylamino]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71770447) has the molecular formula C14H20FNO5 and a molecular weight of 301.31 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[[(4-fluorophenyl)methylamino]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[[(4-fluorophenyl)methylamino]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71770447 |
| Molecular Formula | C14H20FNO5 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[[(4-fluorophenyl)methylamino]methyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](CNCc2ccc(F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H20FNO5/c15-9-3-1-8(2-4-9)5-16-6-10-12(18)14(20)13(19)11(7-17)21-10/h1-4,10-14,16-20H,5-7H2/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | CPRHGXPWSAFUOE-MEBFFEOJSA-N |
| XLogP | -1.24 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |