C12H15N3S — CID 71770457
1-phenyl-1,2,5,6,7,8-hexahydro-[1,2,4]triazolo[1,2-a]pyridazine-3-thione (PubChem CID 71770457) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-phenyl-1,2,5,6,7,8-hexahydro-[1,2,4]triazolo[1,2-a]pyridazine-3-thione.
| Compound Name | 1-phenyl-1,2,5,6,7,8-hexahydro-[1,2,4]triazolo[1,2-a]pyridazine-3-thione |
|---|---|
| PubChem CID | 71770457 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-phenyl-1,2,5,6,7,8-hexahydro-[1,2,4]triazolo[1,2-a]pyridazine-3-thione |
| SMILES | S=C1NC(c2ccccc2)N2CCCCN12 |
| InChI | InChI=1S/C12H15N3S/c16-12-13-11(10-6-2-1-3-7-10)14-8-4-5-9-15(12)14/h1-3,6-7,11H,4-5,8-9H2,(H,13,16) |
| InChIKey | ZEFDFKLSLOSNFW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|