C32H36N6O7 — CID 71770458
[2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 71770458) has the molecular formula C32H36N6O7 and a molecular weight of 616.68 g/mol. Its IUPAC name is [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71770458 |
| Molecular Formula | C32H36N6O7 |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-nitrophenoxy)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)Cn1cnc2c(Oc3ccc([N+](=O)[O-])cc3)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C32H36N6O7/c1-32(2,3)30(40)44-20-43-26(39)18-37-19-34-27-28(37)35-31(36-29(27)45-25-15-13-24(14-16-25)38(41)42)33-17-21-9-11-23(12-10-21)22-7-5-4-6-8-22/h9-16,19,22H,4-8,17-18,20H2,1-3H3,(H,33,35,36) |
| InChIKey | IPRMDHWDQMGATK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|