C14H25NO — CID 71770472
(2S,3S,5E,7E)-2-aminotetradeca-5,7,13-trien-3-ol (PubChem CID 71770472) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2S,3S,5E,7E)-2-aminotetradeca-5,7,13-trien-3-ol.
| Compound Name | (2S,3S,5E,7E)-2-aminotetradeca-5,7,13-trien-3-ol |
|---|---|
| PubChem CID | 71770472 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2S,3S,5E,7E)-2-aminotetradeca-5,7,13-trien-3-ol |
| SMILES | C=CCCCC/C=C/C=C/C[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C14H25NO/c1-3-4-5-6-7-8-9-10-11-12-14(16)13(2)15/h3,8-11,13-14,16H,1,4-7,12,15H2,2H3/b9-8+,11-10+/t13-,14-/m0/s1 |
| InChIKey | CBRBQXWPAPFJPP-UNJVXHDRSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|