C16H31NO — CID 71770473
(2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-ol (PubChem CID 71770473) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is (2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-ol.
| Compound Name | (2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-ol |
|---|---|
| PubChem CID | 71770473 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (2S,3S,5E,9Z)-2-aminohexadeca-5,9-dien-3-ol |
| SMILES | CCCCCC/C=C\CC/C=C/C[C@H](O)[C@H](C)N |
| InChI | InChI=1S/C16H31NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(18)15(2)17/h8-9,12-13,15-16,18H,3-7,10-11,14,17H2,1-2H3/b9-8-,13-12+/t15-,16-/m0/s1 |
| InChIKey | HZSCAIKPGSXTOF-VXGYEUFFSA-N |
| XLogP | 3.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|