C29H31FN6O4 — CID 71770580
acetyloxymethyl 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetate (PubChem CID 71770580) has the molecular formula C29H31FN6O4 and a molecular weight of 546.60 g/mol. Its IUPAC name is acetyloxymethyl 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetate.
| Compound Name | acetyloxymethyl 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetate |
|---|---|
| PubChem CID | 71770580 |
| Molecular Formula | C29H31FN6O4 |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | acetyloxymethyl 2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetate |
| SMILES | CC(=O)OCOC(=O)Cn1cnc2c(Nc3ccc(F)cc3)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C29H31FN6O4/c1-19(37)39-18-40-25(38)16-36-17-32-26-27(33-24-13-11-23(30)12-14-24)34-29(35-28(26)36)31-15-20-7-9-22(10-8-20)21-5-3-2-4-6-21/h7-14,17,21H,2-6,15-16,18H2,1H3,(H2,31,33,34,35) |
| InChIKey | BMKBFHHVPOAIDK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|