About 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate
3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate (PubChem CID 7177062) has the molecular formula C18H28O5-2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate.
Molecular Properties
| Compound Name | 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate |
| PubChem CID | 7177062 |
| Molecular Formula | C18H28O5-2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate |
| SMILES | O=C([O-])CC[C@@H]1CCCCCCCCC[C@@H](CCC(=O)[O-])C1=O |
| InChI | InChI=1S/C18H30O5/c19-16(20)12-10-14-8-6-4-2-1-3-5-7-9-15(18(14)23)11-13-17(21)22/h14-15H,1-13H2,(H,19,20)(H,21,22)/p-2/t14-,15-/m0/s1 |
| InChIKey | YIRDCOUZKYBLJD-GJZGRUSLSA-L |
| XLogP | 1.37 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate?
The IUPAC name of 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate (CID 7177062) is 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate.
What is the SMILES notation for 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate?
The canonical SMILES for 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate is O=C([O-])CC[C@@H]1CCCCCCCCC[C@@H](CCC(=O)[O-])C1=O.
What is the InChIKey of 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate?
The InChIKey is YIRDCOUZKYBLJD-GJZGRUSLSA-L. The full InChI is InChI=1S/C18H30O5/c19-16(20)12-10-14-8-6-4-2-1-3-5-7-9-15(18(14)23)11-13-17(21)22/h14-15H,1-13H2,(H,19,20)(H,21,22)/p-2/t14-,15-/m0/s1.
What are the key properties of 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate?
3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate has a molecular weight of 324.42 g/mol, XLogP of 1.37, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,3S)-3-(2-carboxylatoethyl)-2-oxocyclododecyl]propanoate is sourced from PubChem (CID 7177062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).