C16H23NO5 — CID 71770690
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[[(E)-3-phenylprop-2-enyl]amino]methyl]oxane-3,4,5-triol (PubChem CID 71770690) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[[(E)-3-phenylprop-2-enyl]amino]methyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[[(E)-3-phenylprop-2-enyl]amino]methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71770690 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[[[(E)-3-phenylprop-2-enyl]amino]methyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](CNC/C=C/c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23NO5/c18-10-13-15(20)16(21)14(19)12(22-13)9-17-8-4-7-11-5-2-1-3-6-11/h1-7,12-21H,8-10H2/b7-4+/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | LHEKRJPKKLZBDY-SKWGZQBISA-N |
| XLogP | -0.87 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|