C14H17Cl2NO6 — CID 71770692
2,4-dichloro-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzamide (PubChem CID 71770692) has the molecular formula C14H17Cl2NO6 and a molecular weight of 366.20 g/mol. Its IUPAC name is 2,4-dichloro-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 71770692 |
| Molecular Formula | C14H17Cl2NO6 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2,4-dichloro-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2NO6/c15-6-1-2-7(8(16)3-6)14(22)17-4-9-11(19)13(21)12(20)10(5-18)23-9/h1-3,9-13,18-21H,4-5H2,(H,17,22)/t9-,10+,11-,12+,13+/m0/s1 |
| InChIKey | XAKKCZDLYXXKFR-OBPIAQAESA-N |
| XLogP | -0.43 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |