C33H33N3O10 — CID 71770788
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 71770788) has the molecular formula C33H33N3O10 and a molecular weight of 631.64 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71770788 |
| Molecular Formula | C33H33N3O10 |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-(1H-indole-2-carbonylamino)-8-methyl-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)[nH]2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4cc5ccccc5[nH]4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C33H33N3O10/c1-15-10-12-20(34-15)30(40)45-27-25(38)32(46-33(3,4)28(27)42-5)43-22-13-11-18-24(37)23(31(41)44-26(18)16(22)2)36-29(39)21-14-17-8-6-7-9-19(17)35-21/h6-14,25,27-28,32,34-35,37-38H,1-5H3,(H,36,39)/t25-,27+,28-,32-/m1/s1 |
| InChIKey | MBYSPTWRCBIFPM-WLVDOGIASA-N |
| XLogP | 4.29 |
| TPSA | 185.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|