C10H22O8S2 — CID 71772282
(2S,3R,4R,5S)-1,1-bis(ethylsulfonyl)hexane-2,3,4,5-tetrol (PubChem CID 71772282) has the molecular formula C10H22O8S2 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1,1-bis(ethylsulfonyl)hexane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4R,5S)-1,1-bis(ethylsulfonyl)hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 71772282 |
| Molecular Formula | C10H22O8S2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2S,3R,4R,5S)-1,1-bis(ethylsulfonyl)hexane-2,3,4,5-tetrol |
| SMILES | CCS(=O)(=O)C([C@@H](O)[C@H](O)[C@H](O)[C@H](C)O)S(=O)(=O)CC |
| InChI | InChI=1S/C10H22O8S2/c1-4-19(15,16)10(20(17,18)5-2)9(14)8(13)7(12)6(3)11/h6-14H,4-5H2,1-3H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | GAYPCIYXXTVAMZ-KDXUFGMBSA-N |
| XLogP | -2.35 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |