About 5-benzyl-1,2,4-triazole-3-thione
5-benzyl-1,2,4-triazole-3-thione (PubChem CID 71773682) has the molecular formula C9H7N3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 5-benzyl-1,2,4-triazole-3-thione.
Molecular Properties
| Compound Name | 5-benzyl-1,2,4-triazole-3-thione |
| PubChem CID | 71773682 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5-benzyl-1,2,4-triazole-3-thione |
| SMILES | S=C1N=NC(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C9H7N3S/c13-9-10-8(11-12-9)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UNKWWCQLYLYVOE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-1,2,4-triazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1,2,4-triazole-3-thione?
The IUPAC name of 5-benzyl-1,2,4-triazole-3-thione (CID 71773682) is 5-benzyl-1,2,4-triazole-3-thione.
What is the SMILES notation for 5-benzyl-1,2,4-triazole-3-thione?
The canonical SMILES for 5-benzyl-1,2,4-triazole-3-thione is S=C1N=NC(Cc2ccccc2)=N1.
What is the InChIKey of 5-benzyl-1,2,4-triazole-3-thione?
The InChIKey is UNKWWCQLYLYVOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S/c13-9-10-8(11-12-9)6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 5-benzyl-1,2,4-triazole-3-thione?
5-benzyl-1,2,4-triazole-3-thione has a molecular weight of 189.24 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1,2,4-triazole-3-thione is sourced from PubChem (CID 71773682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).