About 1,1,3-tris(ethenyl)urea
1,1,3-tris(ethenyl)urea (PubChem CID 71773701) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1,1,3-tris(ethenyl)urea.
Molecular Properties
| Compound Name | 1,1,3-tris(ethenyl)urea |
| PubChem CID | 71773701 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 1,1,3-tris(ethenyl)urea |
| SMILES | C=CNC(=O)N(C=C)C=C |
| InChI | InChI=1S/C7H10N2O/c1-4-8-7(10)9(5-2)6-3/h4-6H,1-3H2,(H,8,10) |
| InChIKey | ABTFSJLQPMCOQH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,3-tris(ethenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-tris(ethenyl)urea?
The IUPAC name of 1,1,3-tris(ethenyl)urea (CID 71773701) is 1,1,3-tris(ethenyl)urea.
What is the SMILES notation for 1,1,3-tris(ethenyl)urea?
The canonical SMILES for 1,1,3-tris(ethenyl)urea is C=CNC(=O)N(C=C)C=C.
What is the InChIKey of 1,1,3-tris(ethenyl)urea?
The InChIKey is ABTFSJLQPMCOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-4-8-7(10)9(5-2)6-3/h4-6H,1-3H2,(H,8,10).
What are the key properties of 1,1,3-tris(ethenyl)urea?
1,1,3-tris(ethenyl)urea has a molecular weight of 138.17 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-tris(ethenyl)urea is sourced from PubChem (CID 71773701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).