C7H7F5O2 — CID 71773826
3-(2,2,3,3,3-pentafluoropropoxy)but-3-en-2-one (PubChem CID 71773826) has the molecular formula C7H7F5O2 and a molecular weight of 218.12 g/mol. Its IUPAC name is 3-(2,2,3,3,3-pentafluoropropoxy)but-3-en-2-one.
| Compound Name | 3-(2,2,3,3,3-pentafluoropropoxy)but-3-en-2-one |
|---|---|
| PubChem CID | 71773826 |
| Molecular Formula | C7H7F5O2 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 3-(2,2,3,3,3-pentafluoropropoxy)but-3-en-2-one |
| SMILES | C=C(OCC(F)(F)C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C7H7F5O2/c1-4(13)5(2)14-3-6(8,9)7(10,11)12/h2-3H2,1H3 |
| InChIKey | VHJAPYPGZGTDDO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|