About N-(Ferrocenyl)maleimide
N-(Ferrocenyl)maleimide (PubChem CID 71774911) has the molecular formula C14H11FeNO2
and a molecular weight of 281.09 g/mol.
Molecular Properties
| Compound Name | N-(Ferrocenyl)maleimide |
| PubChem CID | 71774911 |
| Molecular Formula | C14H11FeNO2 |
| Molecular Weight | 281.09 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | — |
| SMILES | O=C1C=CC(=O)N1C1=CC=C[CH]1.[CH]1C=CC=C1.[Fe] |
| InChI | InChI=1S/C9H6NO2.C5H5.Fe/c11-8-5-6-9(12)10(8)7-3-1-2-4-7;1-2-4-5-3-1;/h1-6H;1-5H; |
| InChIKey | NPRQOGNZONJGOQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(Ferrocenyl)maleimide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(Ferrocenyl)maleimide?
The IUPAC name of N-(Ferrocenyl)maleimide (CID 71774911) is not available.
What is the SMILES notation for N-(Ferrocenyl)maleimide?
The canonical SMILES for N-(Ferrocenyl)maleimide is O=C1C=CC(=O)N1C1=CC=C[CH]1.[CH]1C=CC=C1.[Fe].
What is the InChIKey of N-(Ferrocenyl)maleimide?
The InChIKey is NPRQOGNZONJGOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6NO2.C5H5.Fe/c11-8-5-6-9(12)10(8)7-3-1-2-4-7;1-2-4-5-3-1;/h1-6H;1-5H;.
What are the key properties of N-(Ferrocenyl)maleimide?
N-(Ferrocenyl)maleimide has a molecular weight of 281.09 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(Ferrocenyl)maleimide is sourced from PubChem (CID 71774911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).