C23H18N2OS — CID 7177501
(4S)-2-methyl-5-oxo-4-[5-(2-phenylethynyl)thiophen-2-yl]-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile (PubChem CID 7177501) has the molecular formula C23H18N2OS and a molecular weight of 370.48 g/mol. Its IUPAC name is (4S)-2-methyl-5-oxo-4-[5-(2-phenylethynyl)thiophen-2-yl]-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile.
| Compound Name | (4S)-2-methyl-5-oxo-4-[5-(2-phenylethynyl)thiophen-2-yl]-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 7177501 |
| Molecular Formula | C23H18N2OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (4S)-2-methyl-5-oxo-4-[5-(2-phenylethynyl)thiophen-2-yl]-4,6,7,8-tetrahydro-3H-quinoline-3-carbonitrile |
| SMILES | CC1=NC2=C(C(=O)CCC2)[C@@H](c2ccc(C#Cc3ccccc3)s2)C1C#N |
| InChI | InChI=1S/C23H18N2OS/c1-15-18(14-24)22(23-19(25-15)8-5-9-20(23)26)21-13-12-17(27-21)11-10-16-6-3-2-4-7-16/h2-4,6-7,12-13,18,22H,5,8-9H2,1H3/t18?,22-/m1/s1 |
| InChIKey | SNYWIYQXWFQWSJ-LMNIDFBRSA-N |
| XLogP | 4.85 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|