About sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate
sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 71775948) has the molecular formula C8H11NaO3S
and a molecular weight of 210.23 g/mol. Its IUPAC name is sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate.
Molecular Properties
| Compound Name | sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate |
| PubChem CID | 71775948 |
| Molecular Formula | C8H11NaO3S |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CC1C=CC=CC1(C)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H12O3S.Na/c1-7-5-3-4-6-8(7,2)12(9,10)11;/h3-7H,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | ZCOGBQMNWOQJBU-UHFFFAOYSA-M |
| XLogP | -1.94 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate?
The IUPAC name of sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate (CID 71775948) is sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate.
What is the SMILES notation for sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate?
The canonical SMILES for sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate is CC1C=CC=CC1(C)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate?
The InChIKey is ZCOGBQMNWOQJBU-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H12O3S.Na/c1-7-5-3-4-6-8(7,2)12(9,10)11;/h3-7H,1-2H3,(H,9,10,11);/q;+1/p-1.
What are the key properties of sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate?
sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate has a molecular weight of 210.23 g/mol, XLogP of -1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,6-dimethylcyclohexa-2,4-diene-1-sulfonate is sourced from PubChem (CID 71775948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).