C11H10F4N4O2 — CID 71776600
N-(4-azido-2,3,5,6-tetrafluorophenyl)-N-[(2-methylpropan-2-yl)oxy]formamide (PubChem CID 71776600) has the molecular formula C11H10F4N4O2 and a molecular weight of 306.22 g/mol. Its IUPAC name is N-(4-azido-2,3,5,6-tetrafluorophenyl)-N-[(2-methylpropan-2-yl)oxy]formamide.
| Compound Name | N-(4-azido-2,3,5,6-tetrafluorophenyl)-N-[(2-methylpropan-2-yl)oxy]formamide |
|---|---|
| PubChem CID | 71776600 |
| Molecular Formula | C11H10F4N4O2 |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-(4-azido-2,3,5,6-tetrafluorophenyl)-N-[(2-methylpropan-2-yl)oxy]formamide |
| SMILES | CC(C)(C)ON(C=O)c1c(F)c(F)c(N=[N+]=[N-])c(F)c1F |
| InChI | InChI=1S/C11H10F4N4O2/c1-11(2,3)21-19(4-20)10-7(14)5(12)9(17-18-16)6(13)8(10)15/h4H,1-3H3 |
| InChIKey | IVZNZRLTTBOZFM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|