About 2,2-dibromopropanimidamide;dihydrochloride
2,2-dibromopropanimidamide;dihydrochloride (PubChem CID 71777001) has the molecular formula C3H8Br2Cl2N2
and a molecular weight of 302.83 g/mol. Its IUPAC name is 2,2-dibromopropanimidamide;dihydrochloride.
Molecular Properties
| Compound Name | 2,2-dibromopropanimidamide;dihydrochloride |
| PubChem CID | 71777001 |
| Molecular Formula | C3H8Br2Cl2N2 |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 299.84 |
| IUPAC Name | 2,2-dibromopropanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)C(C)(Br)Br |
| InChI | InChI=1S/C3H6Br2N2.2ClH/c1-3(4,5)2(6)7;;/h1H3,(H3,6,7);2*1H |
| InChIKey | USGJOMXLZPPHKY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibromopropanimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibromopropanimidamide;dihydrochloride?
The IUPAC name of 2,2-dibromopropanimidamide;dihydrochloride (CID 71777001) is 2,2-dibromopropanimidamide;dihydrochloride.
What is the SMILES notation for 2,2-dibromopropanimidamide;dihydrochloride?
The canonical SMILES for 2,2-dibromopropanimidamide;dihydrochloride is Cl.Cl.[H]/N=C(\N)C(C)(Br)Br.
What is the InChIKey of 2,2-dibromopropanimidamide;dihydrochloride?
The InChIKey is USGJOMXLZPPHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Br2N2.2ClH/c1-3(4,5)2(6)7;;/h1H3,(H3,6,7);2*1H.
What are the key properties of 2,2-dibromopropanimidamide;dihydrochloride?
2,2-dibromopropanimidamide;dihydrochloride has a molecular weight of 302.83 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromopropanimidamide;dihydrochloride is sourced from PubChem (CID 71777001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).