C9H9F8NOS — CID 71777785
2,2,3,3,4,4,5,5-octafluoro-1-morpholin-4-ylpentane-1-thione (PubChem CID 71777785) has the molecular formula C9H9F8NOS and a molecular weight of 331.23 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-morpholin-4-ylpentane-1-thione.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-morpholin-4-ylpentane-1-thione |
|---|---|
| PubChem CID | 71777785 |
| Molecular Formula | C9H9F8NOS |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-morpholin-4-ylpentane-1-thione |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(=S)N1CCOCC1 |
| InChI | InChI=1S/C9H9F8NOS/c10-5(11)7(12,13)9(16,17)8(14,15)6(20)18-1-3-19-4-2-18/h5H,1-4H2 |
| InChIKey | ULKNNBWCBGUXRU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|