About 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol
4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol (PubChem CID 71777789) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol.
Analyze 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol?
The IUPAC name of 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol (CID 71777789) is 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol.
What is the SMILES notation for 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol?
The canonical SMILES for 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol is OCC1NCCc2sccc21.
What is the InChIKey of 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol?
The InChIKey is VJQBIPPJWWDFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS/c10-5-7-6-2-4-11-8(6)1-3-9-7/h2,4,7,9-10H,1,3,5H2.
What are the key properties of 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol?
4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol has a molecular weight of 169.25 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-ylmethanol is sourced from PubChem (CID 71777789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).