About 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine
4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine (PubChem CID 71778142) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine.
Molecular Properties
| Compound Name | 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine |
| PubChem CID | 71778142 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine |
| SMILES | NCCCCn1ccc2cccnc21 |
| InChI | InChI=1S/C11H15N3/c12-6-1-2-8-14-9-5-10-4-3-7-13-11(10)14/h3-5,7,9H,1-2,6,8,12H2 |
| InChIKey | HWWCFBGUXHCYAZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine?
The IUPAC name of 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine (CID 71778142) is 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine.
What is the SMILES notation for 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine?
The canonical SMILES for 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine is NCCCCn1ccc2cccnc21.
What is the InChIKey of 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine?
The InChIKey is HWWCFBGUXHCYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c12-6-1-2-8-14-9-5-10-4-3-7-13-11(10)14/h3-5,7,9H,1-2,6,8,12H2.
What are the key properties of 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine?
4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine has a molecular weight of 189.26 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolo[2,3-b]pyridin-1-ylbutan-1-amine is sourced from PubChem (CID 71778142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).