About N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide
N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide (PubChem CID 71778707) has the molecular formula C11H10N4O4S
and a molecular weight of 294.29 g/mol. Its IUPAC name is N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide |
| PubChem CID | 71778707 |
| Molecular Formula | C11H10N4O4S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide |
| SMILES | Cn1c(N)c(C(=S)NC(=O)c2ccco2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H10N4O4S/c1-15-7(12)6(9(17)14-11(15)18)10(20)13-8(16)5-3-2-4-19-5/h2-4H,12H2,1H3,(H,13,16,20)(H,14,17,18) |
| InChIKey | CBFUTGJJGCRXER-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide?
The IUPAC name of N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide (CID 71778707) is N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide.
What is the SMILES notation for N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide?
The canonical SMILES for N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide is Cn1c(N)c(C(=S)NC(=O)c2ccco2)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide?
The InChIKey is CBFUTGJJGCRXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O4S/c1-15-7(12)6(9(17)14-11(15)18)10(20)13-8(16)5-3-2-4-19-5/h2-4H,12H2,1H3,(H,13,16,20)(H,14,17,18).
What are the key properties of N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide?
N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide has a molecular weight of 294.29 g/mol, XLogP of -0.65, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-1-methyl-2,4-dioxopyrimidine-5-carbothioyl)furan-2-carboxamide is sourced from PubChem (CID 71778707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).