C8H8N4O2S — CID 71778711
1,3-dimethyl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 71778711) has the molecular formula C8H8N4O2S and a molecular weight of 224.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71778711 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1,3-dimethyl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(=S)nc[nH]c2n(C)c1=O |
| InChI | InChI=1S/C8H8N4O2S/c1-11-5-4(6(15)10-3-9-5)7(13)12(2)8(11)14/h3H,1-2H3,(H,9,10,15) |
| InChIKey | MVSLEZIBPGPYSO-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|