About 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride
5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride (PubChem CID 71779004) has the molecular formula C13H17ClN2O2S
and a molecular weight of 300.81 g/mol. Its IUPAC name is 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride |
| PubChem CID | 71779004 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride |
| SMILES | COc1ccc2sc(OC3CCNCC3)nc2c1.Cl |
| InChI | InChI=1S/C13H16N2O2S.ClH/c1-16-10-2-3-12-11(8-10)15-13(18-12)17-9-4-6-14-7-5-9;/h2-3,8-9,14H,4-7H2,1H3;1H |
| InChIKey | QCJILCGWKKTYLI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride?
The IUPAC name of 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride (CID 71779004) is 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride is COc1ccc2sc(OC3CCNCC3)nc2c1.Cl.
What is the InChIKey of 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride?
The InChIKey is QCJILCGWKKTYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S.ClH/c1-16-10-2-3-12-11(8-10)15-13(18-12)17-9-4-6-14-7-5-9;/h2-3,8-9,14H,4-7H2,1H3;1H.
What are the key properties of 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride?
5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride has a molecular weight of 300.81 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-piperidin-4-yloxy-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 71779004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).