C17H18FNO2S2 — CID 71781727
N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-(4-fluorophenyl)sulfanylacetamide (PubChem CID 71781727) has the molecular formula C17H18FNO2S2 and a molecular weight of 351.47 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-(4-fluorophenyl)sulfanylacetamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-(4-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 71781727 |
| Molecular Formula | C17H18FNO2S2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-2-(4-fluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(F)cc1)NCC(O)(c1cccs1)C1CC1 |
| InChI | InChI=1S/C17H18FNO2S2/c18-13-5-7-14(8-6-13)23-10-16(20)19-11-17(21,12-3-4-12)15-2-1-9-22-15/h1-2,5-9,12,21H,3-4,10-11H2,(H,19,20) |
| InChIKey | GCBJZWRKFYKWQA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |