About N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide
N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide (PubChem CID 71782444) has the molecular formula C21H21NO2S
and a molecular weight of 351.47 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide |
| PubChem CID | 71782444 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)NCC(O)c1cccs1 |
| InChI | InChI=1S/C21H21NO2S/c23-19(20-12-7-13-25-20)15-22-21(24)14-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-13,18-19,23H,14-15H2,(H,22,24) |
| InChIKey | WUQWAHIHWAWITG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide?
The IUPAC name of N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide (CID 71782444) is N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide.
What is the SMILES notation for N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide?
The canonical SMILES for N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide is O=C(CC(c1ccccc1)c1ccccc1)NCC(O)c1cccs1.
What is the InChIKey of N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide?
The InChIKey is WUQWAHIHWAWITG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2S/c23-19(20-12-7-13-25-20)15-22-21(24)14-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-13,18-19,23H,14-15H2,(H,22,24).
What are the key properties of N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide?
N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide has a molecular weight of 351.47 g/mol, XLogP of 4.12, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-2-thiophen-2-ylethyl)-3,3-diphenylpropanamide is sourced from PubChem (CID 71782444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).