C12H13NO3S — CID 71782534
N-[2-(furan-2-yl)-2-hydroxypropyl]thiophene-3-carboxamide (PubChem CID 71782534) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71782534 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]thiophene-3-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccsc1)c1ccco1 |
| InChI | InChI=1S/C12H13NO3S/c1-12(15,10-3-2-5-16-10)8-13-11(14)9-4-6-17-7-9/h2-7,15H,8H2,1H3,(H,13,14) |
| InChIKey | ZXXMNQDXUFKGNL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |