About 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride
5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride (PubChem CID 71782847) has the molecular formula C12H21ClN4O4S
and a molecular weight of 352.84 g/mol. Its IUPAC name is 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride |
| PubChem CID | 71782847 |
| Molecular Formula | C12H21ClN4O4S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCCN2CCN(S(C)(=O)=O)CC2)no1.Cl |
| InChI | InChI=1S/C12H20N4O4S.ClH/c1-10-9-11(14-20-10)12(17)13-3-4-15-5-7-16(8-6-15)21(2,18)19;/h9H,3-8H2,1-2H3,(H,13,17);1H |
| InChIKey | SBGDUADZINZNGX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride?
The IUPAC name of 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride (CID 71782847) is 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride.
What is the SMILES notation for 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride?
The canonical SMILES for 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride is Cc1cc(C(=O)NCCN2CCN(S(C)(=O)=O)CC2)no1.Cl.
What is the InChIKey of 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride?
The InChIKey is SBGDUADZINZNGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O4S.ClH/c1-10-9-11(14-20-10)12(17)13-3-4-15-5-7-16(8-6-15)21(2,18)19;/h9H,3-8H2,1-2H3,(H,13,17);1H.
What are the key properties of 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride?
5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride has a molecular weight of 352.84 g/mol, XLogP of -0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]-1,2-oxazole-3-carboxamide;hydrochloride is sourced from PubChem (CID 71782847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).