C16H15N5O6 — CID 71783925
5-[1-(furan-3-ylmethyl)azetidin-3-yl]-3-pyrimidin-2-yl-1,2,4-oxadiazole;oxalic acid (PubChem CID 71783925) has the molecular formula C16H15N5O6 and a molecular weight of 373.33 g/mol. Its IUPAC name is 5-[1-(furan-3-ylmethyl)azetidin-3-yl]-3-pyrimidin-2-yl-1,2,4-oxadiazole;oxalic acid.
| Compound Name | 5-[1-(furan-3-ylmethyl)azetidin-3-yl]-3-pyrimidin-2-yl-1,2,4-oxadiazole;oxalic acid |
|---|---|
| PubChem CID | 71783925 |
| Molecular Formula | C16H15N5O6 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 5-[1-(furan-3-ylmethyl)azetidin-3-yl]-3-pyrimidin-2-yl-1,2,4-oxadiazole;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1cnc(-c2noc(C3CN(Cc4ccoc4)C3)n2)nc1 |
| InChI | InChI=1S/C14H13N5O2.C2H2O4/c1-3-15-12(16-4-1)13-17-14(21-18-13)11-7-19(8-11)6-10-2-5-20-9-10;3-1(4)2(5)6/h1-5,9,11H,6-8H2;(H,3,4)(H,5,6) |
| InChIKey | GQOSGXYRPOQTEW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|