C16H15N5O6S2 — CID 71784006
oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide (PubChem CID 71784006) has the molecular formula C16H15N5O6S2 and a molecular weight of 437.46 g/mol. Its IUPAC name is oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide.
| Compound Name | oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide |
|---|---|
| PubChem CID | 71784006 |
| Molecular Formula | C16H15N5O6S2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | oxalic acid;N-(1,3-thiazol-2-yl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)azetidin-1-yl]acetamide |
| SMILES | O=C(CN1CC(c2nc(-c3cccs3)no2)C1)Nc1nccs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H13N5O2S2.C2H2O4/c20-11(16-14-15-3-5-23-14)8-19-6-9(7-19)13-17-12(18-21-13)10-2-1-4-22-10;3-1(4)2(5)6/h1-5,9H,6-8H2,(H,15,16,20);(H,3,4)(H,5,6) |
| InChIKey | ZVIGZFAJKCUFEU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|