C21H23N5O7 — CID 71784024
5-[1-[(4-ethoxy-3-methoxyphenyl)methyl]azetidin-3-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole;oxalic acid (PubChem CID 71784024) has the molecular formula C21H23N5O7 and a molecular weight of 457.44 g/mol. Its IUPAC name is 5-[1-[(4-ethoxy-3-methoxyphenyl)methyl]azetidin-3-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole;oxalic acid.
| Compound Name | 5-[1-[(4-ethoxy-3-methoxyphenyl)methyl]azetidin-3-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole;oxalic acid |
|---|---|
| PubChem CID | 71784024 |
| Molecular Formula | C21H23N5O7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 5-[1-[(4-ethoxy-3-methoxyphenyl)methyl]azetidin-3-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole;oxalic acid |
| SMILES | CCOc1ccc(CN2CC(c3nc(-c4cnccn4)no3)C2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H21N5O3.C2H2O4/c1-3-26-16-5-4-13(8-17(16)25-2)10-24-11-14(12-24)19-22-18(23-27-19)15-9-20-6-7-21-15;3-1(4)2(5)6/h4-9,14H,3,10-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SRYOTNSGVYULFN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 161.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|