C15H17N3O8 — CID 71784548
ethyl 2-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetate;oxalic acid (PubChem CID 71784548) has the molecular formula C15H17N3O8 and a molecular weight of 367.31 g/mol. Its IUPAC name is ethyl 2-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetate;oxalic acid.
| Compound Name | ethyl 2-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetate;oxalic acid |
|---|---|
| PubChem CID | 71784548 |
| Molecular Formula | C15H17N3O8 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | ethyl 2-[3-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]azetidin-1-yl]acetate;oxalic acid |
| SMILES | CCOC(=O)CN1CC(c2nc(-c3ccco3)no2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H15N3O4.C2H2O4/c1-2-18-11(17)8-16-6-9(7-16)13-14-12(15-20-13)10-4-3-5-19-10;3-1(4)2(5)6/h3-5,9H,2,6-8H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | CGPZECVDNYTIQP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 156.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|