C20H29N3O4 — CID 71784687
formic acid;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-(1-methylindol-3-yl)acetamide (PubChem CID 71784687) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is formic acid;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-(1-methylindol-3-yl)acetamide.
| Compound Name | formic acid;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 71784687 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | formic acid;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-(1-methylindol-3-yl)acetamide |
| SMILES | COCCN1CCC(NC(=O)Cc2cn(C)c3ccccc23)CC1.O=CO |
| InChI | InChI=1S/C19H27N3O2.CH2O2/c1-21-14-15(17-5-3-4-6-18(17)21)13-19(23)20-16-7-9-22(10-8-16)11-12-24-2;2-1-3/h3-6,14,16H,7-13H2,1-2H3,(H,20,23);1H,(H,2,3) |
| InChIKey | BGEIPESKNVIOAT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|