About 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide
4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 71784791) has the molecular formula C16H32N4O
and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide |
| PubChem CID | 71784791 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC(CN2CCN(C)CC2C)CC1 |
| InChI | InChI=1S/C16H32N4O/c1-13(2)17-16(21)19-7-5-15(6-8-19)12-20-10-9-18(4)11-14(20)3/h13-15H,5-12H2,1-4H3,(H,17,21) |
| InChIKey | UWKAPPSLLUOJAH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide?
The IUPAC name of 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide (CID 71784791) is 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide.
What is the SMILES notation for 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide?
The canonical SMILES for 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide is CC(C)NC(=O)N1CCC(CN2CCN(C)CC2C)CC1.
What is the InChIKey of 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide?
The InChIKey is UWKAPPSLLUOJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4O/c1-13(2)17-16(21)19-7-5-15(6-8-19)12-20-10-9-18(4)11-14(20)3/h13-15H,5-12H2,1-4H3,(H,17,21).
What are the key properties of 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide?
4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide has a molecular weight of 296.46 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dimethylpiperazin-1-yl)methyl]-N-propan-2-ylpiperidine-1-carboxamide is sourced from PubChem (CID 71784791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).