About 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine
2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine (PubChem CID 71784850) has the molecular formula C21H28N2O3
and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine.
Molecular Properties
| Compound Name | 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine |
| PubChem CID | 71784850 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine |
| SMILES | COc1cc(COCC2CCN(Cc3ccccn3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-24-20-11-18(12-21(13-20)25-2)16-26-15-17-6-9-23(10-7-17)14-19-5-3-4-8-22-19/h3-5,8,11-13,17H,6-7,9-10,14-16H2,1-2H3 |
| InChIKey | GPDBTNWSCCWUBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine?
The IUPAC name of 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine (CID 71784850) is 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine.
What is the SMILES notation for 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine?
The canonical SMILES for 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine is COc1cc(COCC2CCN(Cc3ccccn3)CC2)cc(OC)c1.
What is the InChIKey of 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine?
The InChIKey is GPDBTNWSCCWUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O3/c1-24-20-11-18(12-21(13-20)25-2)16-26-15-17-6-9-23(10-7-17)14-19-5-3-4-8-22-19/h3-5,8,11-13,17H,6-7,9-10,14-16H2,1-2H3.
What are the key properties of 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine?
2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine has a molecular weight of 356.47 g/mol, XLogP of 3.53, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[(3,5-dimethoxyphenyl)methoxymethyl]piperidin-1-yl]methyl]pyridine is sourced from PubChem (CID 71784850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).