About 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea
1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea (PubChem CID 7178514) has the molecular formula C9H16N2O2S2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea.
Molecular Properties
| Compound Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea |
| PubChem CID | 7178514 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N[C@@]1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-3-5-10-8(14)11-9(2)4-6-15(12,13)7-9/h3H,1,4-7H2,2H3,(H2,10,11,14)/t9-/m0/s1 |
| InChIKey | UHROJAJPLIKRPJ-VIFPVBQESA-N |
| XLogP | 0.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea?
The IUPAC name of 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea (CID 7178514) is 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea.
What is the SMILES notation for 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea?
The canonical SMILES for 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea is C=CCNC(=S)N[C@@]1(C)CCS(=O)(=O)C1.
What is the InChIKey of 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea?
The InChIKey is UHROJAJPLIKRPJ-VIFPVBQESA-N. The full InChI is InChI=1S/C9H16N2O2S2/c1-3-5-10-8(14)11-9(2)4-6-15(12,13)7-9/h3H,1,4-7H2,2H3,(H2,10,11,14)/t9-/m0/s1.
What are the key properties of 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea?
1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea has a molecular weight of 248.37 g/mol, XLogP of 0.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-prop-2-enylthiourea is sourced from PubChem (CID 7178514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).