About 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide
1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide (PubChem CID 71785163) has the molecular formula C12H22N2O4
and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide |
| PubChem CID | 71785163 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide |
| SMILES | CCOC(CNC(=O)C1CN(C(C)=O)C1)OCC |
| InChI | InChI=1S/C12H22N2O4/c1-4-17-11(18-5-2)6-13-12(16)10-7-14(8-10)9(3)15/h10-11H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | QQUARTGXBTYDMN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide?
The IUPAC name of 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide (CID 71785163) is 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide.
What is the SMILES notation for 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide?
The canonical SMILES for 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide is CCOC(CNC(=O)C1CN(C(C)=O)C1)OCC.
What is the InChIKey of 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide?
The InChIKey is QQUARTGXBTYDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4/c1-4-17-11(18-5-2)6-13-12(16)10-7-14(8-10)9(3)15/h10-11H,4-8H2,1-3H3,(H,13,16).
What are the key properties of 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide?
1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide has a molecular weight of 258.32 g/mol, XLogP of -0.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-(2,2-diethoxyethyl)azetidine-3-carboxamide is sourced from PubChem (CID 71785163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).