C10H13NO3S — CID 71785831
[3-(hydroxymethyl)morpholin-4-yl]-thiophen-3-ylmethanone (PubChem CID 71785831) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is [3-(hydroxymethyl)morpholin-4-yl]-thiophen-3-ylmethanone.
| Compound Name | [3-(hydroxymethyl)morpholin-4-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 71785831 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | [3-(hydroxymethyl)morpholin-4-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCOCC1CO |
| InChI | InChI=1S/C10H13NO3S/c12-5-9-6-14-3-2-11(9)10(13)8-1-4-15-7-8/h1,4,7,9,12H,2-3,5-6H2 |
| InChIKey | MAWODOKHFIKNFO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |