About N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide
N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide (PubChem CID 71786332) has the molecular formula C13H19N5O2
and a molecular weight of 277.33 g/mol. Its IUPAC name is N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide.
Molecular Properties
| Compound Name | N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide |
| PubChem CID | 71786332 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide |
| SMILES | CNC(=O)C(=O)NCC1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C13H19N5O2/c1-14-12(19)13(20)17-8-10-2-6-18(7-3-10)11-9-15-4-5-16-11/h4-5,9-10H,2-3,6-8H2,1H3,(H,14,19)(H,17,20) |
| InChIKey | UCMBYAACCDJRCD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide?
The IUPAC name of N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide (CID 71786332) is N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide.
What is the SMILES notation for N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide?
The canonical SMILES for N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide is CNC(=O)C(=O)NCC1CCN(c2cnccn2)CC1.
What is the InChIKey of N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide?
The InChIKey is UCMBYAACCDJRCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O2/c1-14-12(19)13(20)17-8-10-2-6-18(7-3-10)11-9-15-4-5-16-11/h4-5,9-10H,2-3,6-8H2,1H3,(H,14,19)(H,17,20).
What are the key properties of N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide?
N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide has a molecular weight of 277.33 g/mol, XLogP of -0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]oxamide is sourced from PubChem (CID 71786332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).