About N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide
N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide (PubChem CID 71787568) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide |
| PubChem CID | 71787568 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCC(O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-11(2,3)9(14)7-8-13-10(15)12(4,5)6/h9,14H,7-8H2,1-6H3,(H,13,15) |
| InChIKey | KTWIMSXYSAVIOM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide (CID 71787568) is N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)NCCC(O)C(C)(C)C.
What is the InChIKey of N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide?
The InChIKey is KTWIMSXYSAVIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-11(2,3)9(14)7-8-13-10(15)12(4,5)6/h9,14H,7-8H2,1-6H3,(H,13,15).
What are the key properties of N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide?
N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide has a molecular weight of 215.34 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-4,4-dimethylpentyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 71787568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).