About N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide
N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide (PubChem CID 71787593) has the molecular formula C16H25NO2S
and a molecular weight of 295.45 g/mol. Its IUPAC name is N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide |
| PubChem CID | 71787593 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide |
| SMILES | CC(C)(C)C(O)CCNC(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C16H25NO2S/c1-16(2,3)14(18)9-11-17-15(19)10-12-20-13-7-5-4-6-8-13/h4-8,14,18H,9-12H2,1-3H3,(H,17,19) |
| InChIKey | FXMCQRJXJDLEMP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide?
The IUPAC name of N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide (CID 71787593) is N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide.
What is the SMILES notation for N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide?
The canonical SMILES for N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide is CC(C)(C)C(O)CCNC(=O)CCSc1ccccc1.
What is the InChIKey of N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide?
The InChIKey is FXMCQRJXJDLEMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2S/c1-16(2,3)14(18)9-11-17-15(19)10-12-20-13-7-5-4-6-8-13/h4-8,14,18H,9-12H2,1-3H3,(H,17,19).
What are the key properties of N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide?
N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide has a molecular weight of 295.45 g/mol, XLogP of 3.08, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylsulfanylpropanamide is sourced from PubChem (CID 71787593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).