C20H24N6O2 — CID 71788563
[4-(2-imidazol-1-ylethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 71788563) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is [4-(2-imidazol-1-ylethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [4-(2-imidazol-1-ylethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 71788563 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [4-(2-imidazol-1-ylethyl)piperazin-1-yl]-[3-(3-methoxyphenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCN(CCn4ccnc4)CC3)[nH]n2)c1 |
| InChI | InChI=1S/C20H24N6O2/c1-28-17-4-2-3-16(13-17)18-14-19(23-22-18)20(27)26-11-9-24(10-12-26)7-8-25-6-5-21-15-25/h2-6,13-15H,7-12H2,1H3,(H,22,23) |
| InChIKey | OMVMRLZTEIXXEZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |