About 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone
6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone (PubChem CID 71789424) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone |
| PubChem CID | 71789424 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone |
| SMILES | O=C(c1cnn2c1OCCC2)N1CCCCC1 |
| InChI | InChI=1S/C12H17N3O2/c16-11(14-5-2-1-3-6-14)10-9-13-15-7-4-8-17-12(10)15/h9H,1-8H2 |
| InChIKey | WEJJHTUGWGJYGL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone?
The IUPAC name of 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone (CID 71789424) is 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone.
What is the SMILES notation for 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone?
The canonical SMILES for 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone is O=C(c1cnn2c1OCCC2)N1CCCCC1.
What is the InChIKey of 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone?
The InChIKey is WEJJHTUGWGJYGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c16-11(14-5-2-1-3-6-14)10-9-13-15-7-4-8-17-12(10)15/h9H,1-8H2.
What are the key properties of 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone?
6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone has a molecular weight of 235.29 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl(piperidin-1-yl)methanone is sourced from PubChem (CID 71789424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).