About 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide
2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 71789676) has the molecular formula C11H13N3O2S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 71789676 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(CCNC(=O)c2csc(C)n2)on1 |
| InChI | InChI=1S/C11H13N3O2S/c1-7-5-9(16-14-7)3-4-12-11(15)10-6-17-8(2)13-10/h5-6H,3-4H2,1-2H3,(H,12,15) |
| InChIKey | YBSJFRZPYDJVBO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide (CID 71789676) is 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide is Cc1cc(CCNC(=O)c2csc(C)n2)on1.
What is the InChIKey of 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide?
The InChIKey is YBSJFRZPYDJVBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S/c1-7-5-9(16-14-7)3-4-12-11(15)10-6-17-8(2)13-10/h5-6H,3-4H2,1-2H3,(H,12,15).
What are the key properties of 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide?
2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide has a molecular weight of 251.31 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 71789676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).