About 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea
1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea (PubChem CID 71789744) has the molecular formula C13H14FN3O2
and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea |
| PubChem CID | 71789744 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea |
| SMILES | Cc1cc(CCNC(=O)Nc2ccc(F)cc2)on1 |
| InChI | InChI=1S/C13H14FN3O2/c1-9-8-12(19-17-9)6-7-15-13(18)16-11-4-2-10(14)3-5-11/h2-5,8H,6-7H2,1H3,(H2,15,16,18) |
| InChIKey | MNPNRWGSCLJNMQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea?
The IUPAC name of 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea (CID 71789744) is 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea.
What is the SMILES notation for 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea?
The canonical SMILES for 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea is Cc1cc(CCNC(=O)Nc2ccc(F)cc2)on1.
What is the InChIKey of 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea?
The InChIKey is MNPNRWGSCLJNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O2/c1-9-8-12(19-17-9)6-7-15-13(18)16-11-4-2-10(14)3-5-11/h2-5,8H,6-7H2,1H3,(H2,15,16,18).
What are the key properties of 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea?
1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea has a molecular weight of 263.27 g/mol, XLogP of 2.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-3-[2-(3-methyl-1,2-oxazol-5-yl)ethyl]urea is sourced from PubChem (CID 71789744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).