C17H18N4O — CID 71790768
1-(2-phenylethyl)-3-(pyrazolo[1,5-a]pyridin-3-ylmethyl)urea (PubChem CID 71790768) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-(pyrazolo[1,5-a]pyridin-3-ylmethyl)urea.
| Compound Name | 1-(2-phenylethyl)-3-(pyrazolo[1,5-a]pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 71790768 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-(2-phenylethyl)-3-(pyrazolo[1,5-a]pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCCc1ccccc1)NCc1cnn2ccccc12 |
| InChI | InChI=1S/C17H18N4O/c22-17(18-10-9-14-6-2-1-3-7-14)19-12-15-13-20-21-11-5-4-8-16(15)21/h1-8,11,13H,9-10,12H2,(H2,18,19,22) |
| InChIKey | YXLGYXOLSIDOHT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |