C15H15N5O2S — CID 71790801
N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 71790801) has the molecular formula C15H15N5O2S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 71790801 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCCn1nc(-n2cccn2)ccc1=O |
| InChI | InChI=1S/C15H15N5O2S/c21-14(11-12-3-1-10-23-12)16-7-9-20-15(22)5-4-13(18-20)19-8-2-6-17-19/h1-6,8,10H,7,9,11H2,(H,16,21) |
| InChIKey | ZVIAFQRHVNPWRZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |