C20H17N5O5 — CID 71791047
N-[4-[4-(2-methoxyethyl)-5-oxotetrazol-1-yl]phenyl]-2-oxochromene-3-carboxamide (PubChem CID 71791047) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyethyl)-5-oxotetrazol-1-yl]phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyethyl)-5-oxotetrazol-1-yl]phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 71791047 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[4-[4-(2-methoxyethyl)-5-oxotetrazol-1-yl]phenyl]-2-oxochromene-3-carboxamide |
| SMILES | COCCn1nnn(-c2ccc(NC(=O)c3cc4ccccc4oc3=O)cc2)c1=O |
| InChI | InChI=1S/C20H17N5O5/c1-29-11-10-24-20(28)25(23-22-24)15-8-6-14(7-9-15)21-18(26)16-12-13-4-2-3-5-17(13)30-19(16)27/h2-9,12H,10-11H2,1H3,(H,21,26) |
| InChIKey | IAKQDPGAALBOSM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|