About 2-benzamido-4,5-dimethoxybenzoic acid
2-benzamido-4,5-dimethoxybenzoic acid (PubChem CID 717923) has the molecular formula C16H15NO5
and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-benzamido-4,5-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 2-benzamido-4,5-dimethoxybenzoic acid |
| PubChem CID | 717923 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-benzamido-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H15NO5/c1-21-13-8-11(16(19)20)12(9-14(13)22-2)17-15(18)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | OJVAHJWDGCQYKM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzamido-4,5-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamido-4,5-dimethoxybenzoic acid?
The IUPAC name of 2-benzamido-4,5-dimethoxybenzoic acid (CID 717923) is 2-benzamido-4,5-dimethoxybenzoic acid.
What is the SMILES notation for 2-benzamido-4,5-dimethoxybenzoic acid?
The canonical SMILES for 2-benzamido-4,5-dimethoxybenzoic acid is COc1cc(NC(=O)c2ccccc2)c(C(=O)O)cc1OC.
What is the InChIKey of 2-benzamido-4,5-dimethoxybenzoic acid?
The InChIKey is OJVAHJWDGCQYKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO5/c1-21-13-8-11(16(19)20)12(9-14(13)22-2)17-15(18)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 2-benzamido-4,5-dimethoxybenzoic acid?
2-benzamido-4,5-dimethoxybenzoic acid has a molecular weight of 301.30 g/mol, XLogP of 2.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamido-4,5-dimethoxybenzoic acid is sourced from PubChem (CID 717923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).